C12H16O — CID 57127371
3-ethoxy-1,2,4a,8a-tetrahydronaphthalene (PubChem CID 57127371) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethoxy-1,2,4a,8a-tetrahydronaphthalene.
| Compound Name | 3-ethoxy-1,2,4a,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 57127371 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-ethoxy-1,2,4a,8a-tetrahydronaphthalene |
| SMILES | CCOC1=CC2C=CC=CC2CC1 |
| InChI | InChI=1S/C12H16O/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | UKYDUXDKGSWSRC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |