About 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene
8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene (PubChem CID 123166540) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene.
Analyze 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene?
The IUPAC name of 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene (CID 123166540) is 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene.
What is the SMILES notation for 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene?
The canonical SMILES for 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene is C1=CCC2C(=C1)OC=CCC1C=CC=CC12.
What is the InChIKey of 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene?
The InChIKey is RKXAVIGSSRNLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-6,8,10-14H,7,9H2.
What are the key properties of 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene?
8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene has a molecular weight of 212.29 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxatricyclo[10.4.0.02,7]hexadeca-4,6,9,13,15-pentaene is sourced from PubChem (CID 123166540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).