C13H20O — CID 89060480
4-butan-2-yl-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 89060480) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-butan-2-yl-3,4,7,8-tetrahydro-2H-chromene.
| Compound Name | 4-butan-2-yl-3,4,7,8-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 89060480 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 4-butan-2-yl-3,4,7,8-tetrahydro-2H-chromene |
| SMILES | CCC(C)C1CCOC2=C1C=CCC2 |
| InChI | InChI=1S/C13H20O/c1-3-10(2)11-8-9-14-13-7-5-4-6-12(11)13/h4,6,10-11H,3,5,7-9H2,1-2H3 |
| InChIKey | XSBLUGHYQYLPAS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |