C9H12O — CID 57183798
6,7,8,8a-tetrahydro-1H-isochromene (PubChem CID 57183798) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 6,7,8,8a-tetrahydro-1H-isochromene.
| Compound Name | 6,7,8,8a-tetrahydro-1H-isochromene |
|---|---|
| PubChem CID | 57183798 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 6,7,8,8a-tetrahydro-1H-isochromene |
| SMILES | C1=CC2=CCCCC2CO1 |
| InChI | InChI=1S/C9H12O/c1-2-4-9-7-10-6-5-8(9)3-1/h3,5-6,9H,1-2,4,7H2 |
| InChIKey | NJGUESIGKDFTGG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |