C16H30O — CID 54556173
3-(2-ethylhexa-1,3-dienoxymethyl)heptane (PubChem CID 54556173) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 3-(2-ethylhexa-1,3-dienoxymethyl)heptane.
| Compound Name | 3-(2-ethylhexa-1,3-dienoxymethyl)heptane |
|---|---|
| PubChem CID | 54556173 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 3-(2-ethylhexa-1,3-dienoxymethyl)heptane |
| SMILES | CCC=CC(=COCC(CC)CCCC)CC |
| InChI | InChI=1S/C16H30O/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2/h9,11,13,16H,5-8,10,12,14H2,1-4H3 |
| InChIKey | ZNHVLWQFKKABOC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|