C5H13N3O2 — CID 57128003
4-nitropentane-1,2-diamine (PubChem CID 57128003) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-nitropentane-1,2-diamine.
| Compound Name | 4-nitropentane-1,2-diamine |
|---|---|
| PubChem CID | 57128003 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 4-nitropentane-1,2-diamine |
| SMILES | CC(CC(N)CN)[N+](=O)[O-] |
| InChI | InChI=1S/C5H13N3O2/c1-4(8(9)10)2-5(7)3-6/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | HRLMGRCYTHRQQB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|