About 4-nitropentane-1,2-diamine
4-nitropentane-1,2-diamine (PubChem CID 57128003) has the molecular formula C5H13N3O2
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-nitropentane-1,2-diamine.
Molecular Properties
| Compound Name | 4-nitropentane-1,2-diamine |
| PubChem CID | 57128003 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 4-nitropentane-1,2-diamine |
| SMILES | CC(CC(N)CN)[N+](=O)[O-] |
| InChI | InChI=1S/C5H13N3O2/c1-4(8(9)10)2-5(7)3-6/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | HRLMGRCYTHRQQB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitropentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitropentane-1,2-diamine?
The IUPAC name of 4-nitropentane-1,2-diamine (CID 57128003) is 4-nitropentane-1,2-diamine.
What is the SMILES notation for 4-nitropentane-1,2-diamine?
The canonical SMILES for 4-nitropentane-1,2-diamine is CC(CC(N)CN)[N+](=O)[O-].
What is the InChIKey of 4-nitropentane-1,2-diamine?
The InChIKey is HRLMGRCYTHRQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O2/c1-4(8(9)10)2-5(7)3-6/h4-5H,2-3,6-7H2,1H3.
What are the key properties of 4-nitropentane-1,2-diamine?
4-nitropentane-1,2-diamine has a molecular weight of 147.18 g/mol, XLogP of -0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitropentane-1,2-diamine is sourced from PubChem (CID 57128003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).