About cyclodecyloxyboronic acid
cyclodecyloxyboronic acid (PubChem CID 57131416) has the molecular formula C10H21BO3
and a molecular weight of 200.09 g/mol. Its IUPAC name is cyclodecyloxyboronic acid.
Molecular Properties
| Compound Name | cyclodecyloxyboronic acid |
| PubChem CID | 57131416 |
| Molecular Formula | C10H21BO3 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | cyclodecyloxyboronic acid |
| SMILES | OB(O)OC1CCCCCCCCC1 |
| InChI | InChI=1S/C10H21BO3/c12-11(13)14-10-8-6-4-2-1-3-5-7-9-10/h10,12-13H,1-9H2 |
| InChIKey | CADWJHIDIXJPIF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclodecyloxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclodecyloxyboronic acid?
The IUPAC name of cyclodecyloxyboronic acid (CID 57131416) is cyclodecyloxyboronic acid.
What is the SMILES notation for cyclodecyloxyboronic acid?
The canonical SMILES for cyclodecyloxyboronic acid is OB(O)OC1CCCCCCCCC1.
What is the InChIKey of cyclodecyloxyboronic acid?
The InChIKey is CADWJHIDIXJPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21BO3/c12-11(13)14-10-8-6-4-2-1-3-5-7-9-10/h10,12-13H,1-9H2.
What are the key properties of cyclodecyloxyboronic acid?
cyclodecyloxyboronic acid has a molecular weight of 200.09 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclodecyloxyboronic acid is sourced from PubChem (CID 57131416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).