C30H32F2N2O4 — CID 57132413
2-[1-[3-[4-(1,2-dihydroxyethyl)-2-methoxyphenoxy]propyl]-2,2-bis(4-fluorophenyl)pyrrolidin-3-yl]acetonitrile (PubChem CID 57132413) has the molecular formula C30H32F2N2O4 and a molecular weight of 522.59 g/mol. Its IUPAC name is 2-[1-[3-[4-(1,2-dihydroxyethyl)-2-methoxyphenoxy]propyl]-2,2-bis(4-fluorophenyl)pyrrolidin-3-yl]acetonitrile.
| Compound Name | 2-[1-[3-[4-(1,2-dihydroxyethyl)-2-methoxyphenoxy]propyl]-2,2-bis(4-fluorophenyl)pyrrolidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 57132413 |
| Molecular Formula | C30H32F2N2O4 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[1-[3-[4-(1,2-dihydroxyethyl)-2-methoxyphenoxy]propyl]-2,2-bis(4-fluorophenyl)pyrrolidin-3-yl]acetonitrile |
| SMILES | COc1cc(C(O)CO)ccc1OCCCN1CCC(CC#N)C1(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H32F2N2O4/c1-37-29-19-21(27(36)20-35)3-12-28(29)38-18-2-16-34-17-14-24(13-15-33)30(34,22-4-8-25(31)9-5-22)23-6-10-26(32)11-7-23/h3-12,19,24,27,35-36H,2,13-14,16-18,20H2,1H3 |
| InChIKey | RSTNEBGUVCCAAL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|