C31H35F2NO4 — CID 70373174
1-[4-[4-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]butoxy]-3-methoxyphenyl]ethanone (PubChem CID 70373174) has the molecular formula C31H35F2NO4 and a molecular weight of 523.62 g/mol. Its IUPAC name is 1-[4-[4-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]butoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[4-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]butoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 70373174 |
| Molecular Formula | C31H35F2NO4 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 1-[4-[4-[2,2-bis(4-fluorophenyl)-4-(hydroxymethyl)piperidin-1-yl]butoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCCN1CCC(CO)CC1(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H35F2NO4/c1-22(36)24-5-14-29(30(19-24)37-2)38-18-4-3-16-34-17-15-23(21-35)20-31(34,25-6-10-27(32)11-7-25)26-8-12-28(33)13-9-26/h5-14,19,23,35H,3-4,15-18,20-21H2,1-2H3 |
| InChIKey | SKTMBPSJSTXPOK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|