C20H27N3O6S2 — CID 57132979
methyl 5-[(2R,3S)-3-(isoquinolin-5-ylsulfonylamino)-1-methylsulfonylpyrrolidin-2-yl]pentanoate (PubChem CID 57132979) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is methyl 5-[(2R,3S)-3-(isoquinolin-5-ylsulfonylamino)-1-methylsulfonylpyrrolidin-2-yl]pentanoate.
| Compound Name | methyl 5-[(2R,3S)-3-(isoquinolin-5-ylsulfonylamino)-1-methylsulfonylpyrrolidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 57132979 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 5-[(2R,3S)-3-(isoquinolin-5-ylsulfonylamino)-1-methylsulfonylpyrrolidin-2-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1[C@@H](NS(=O)(=O)c2cccc3cnccc23)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C20H27N3O6S2/c1-29-20(24)9-4-3-7-18-17(11-13-23(18)30(2,25)26)22-31(27,28)19-8-5-6-15-14-21-12-10-16(15)19/h5-6,8,10,12,14,17-18,22H,3-4,7,9,11,13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | XXKJECLSKXAFRT-ZWKOTPCHSA-N |
| XLogP | 1.65 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|