C17H17ClO6S — CID 57136450
2-[3-(3-chloro-4-methylphenyl)sulfonylpropylperoxy]benzoic acid (PubChem CID 57136450) has the molecular formula C17H17ClO6S and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-methylphenyl)sulfonylpropylperoxy]benzoic acid.
| Compound Name | 2-[3-(3-chloro-4-methylphenyl)sulfonylpropylperoxy]benzoic acid |
|---|---|
| PubChem CID | 57136450 |
| Molecular Formula | C17H17ClO6S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[3-(3-chloro-4-methylphenyl)sulfonylpropylperoxy]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)CCCOOc2ccccc2C(=O)O)cc1Cl |
| InChI | InChI=1S/C17H17ClO6S/c1-12-7-8-13(11-15(12)18)25(21,22)10-4-9-23-24-16-6-3-2-5-14(16)17(19)20/h2-3,5-8,11H,4,9-10H2,1H3,(H,19,20) |
| InChIKey | VNQIZCPKTLEWGB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|