C29H30N4O2 — CID 57139910
(2S)-N-(1-benzhydrylazetidin-3-yl)-1-(1,3-benzoxazol-2-yl)piperidine-2-carboxamide (PubChem CID 57139910) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (2S)-N-(1-benzhydrylazetidin-3-yl)-1-(1,3-benzoxazol-2-yl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(1-benzhydrylazetidin-3-yl)-1-(1,3-benzoxazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 57139910 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2S)-N-(1-benzhydrylazetidin-3-yl)-1-(1,3-benzoxazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(NC1CN(C(c2ccccc2)c2ccccc2)C1)[C@@H]1CCCCN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C29H30N4O2/c34-28(25-16-9-10-18-33(25)29-31-24-15-7-8-17-26(24)35-29)30-23-19-32(20-23)27(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-8,11-15,17,23,25,27H,9-10,16,18-20H2,(H,30,34)/t25-/m0/s1 |
| InChIKey | DVAGURFSEKIHOR-VWLOTQADSA-N |
| XLogP | 4.78 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |