C25H28N4O3 — CID 57141412
methyl 4-(5-aminopentyl)-2-(1-ethylindol-3-yl)-3-oxoquinoxaline-6-carboxylate (PubChem CID 57141412) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 4-(5-aminopentyl)-2-(1-ethylindol-3-yl)-3-oxoquinoxaline-6-carboxylate.
| Compound Name | methyl 4-(5-aminopentyl)-2-(1-ethylindol-3-yl)-3-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 57141412 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | methyl 4-(5-aminopentyl)-2-(1-ethylindol-3-yl)-3-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1cc(-c2nc3ccc(C(=O)OC)cc3n(CCCCCN)c2=O)c2ccccc21 |
| InChI | InChI=1S/C25H28N4O3/c1-3-28-16-19(18-9-5-6-10-21(18)28)23-24(30)29(14-8-4-7-13-26)22-15-17(25(31)32-2)11-12-20(22)27-23/h5-6,9-12,15-16H,3-4,7-8,13-14,26H2,1-2H3 |
| InChIKey | WUIQOAKSUQLSCZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|