C25H35ClO — CID 57143303
(8R,9R,10S,13S,14S)-17-(2-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 57143303) has the molecular formula C25H35ClO and a molecular weight of 387.01 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-(2-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9R,10S,13S,14S)-17-(2-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 57143303 |
| Molecular Formula | C25H35ClO |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-(2-chlorophenoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(Oc3ccccc3Cl)CC[C@@H]12 |
| InChI | InChI=1S/C25H35ClO/c1-24-15-6-5-7-17(24)10-11-18-19-12-13-23(25(19,2)16-14-20(18)24)27-22-9-4-3-8-21(22)26/h3-4,8-9,17-20,23H,5-7,10-16H2,1-2H3/t17?,18-,19-,20+,23?,24-,25-/m0/s1 |
| InChIKey | HMMIZZNDQHNGAQ-JJNLAHGLSA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |