C24H34ClNO2S — CID 57129999
3-chloro-4-[[(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-sulfanylpyridin-2-one (PubChem CID 57129999) has the molecular formula C24H34ClNO2S and a molecular weight of 436.06 g/mol. Its IUPAC name is 3-chloro-4-[[(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-sulfanylpyridin-2-one.
| Compound Name | 3-chloro-4-[[(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-sulfanylpyridin-2-one |
|---|---|
| PubChem CID | 57129999 |
| Molecular Formula | C24H34ClNO2S |
| Molecular Weight | 436.06 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 3-chloro-4-[[(8R,9R,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-1-sulfanylpyridin-2-one |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(Oc3ccn(S)c(=O)c3Cl)CC[C@@H]12 |
| InChI | InChI=1S/C24H34ClNO2S/c1-23-12-4-3-5-15(23)6-7-16-17-8-9-20(24(17,2)13-10-18(16)23)28-19-11-14-26(29)22(27)21(19)25/h11,14-18,20,29H,3-10,12-13H2,1-2H3/t15?,16-,17-,18+,20?,23-,24-/m0/s1 |
| InChIKey | YYSUQCHXGHFYJQ-YWPJORQZSA-N |
| XLogP | 6.37 |
| TPSA | 31.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.06 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|