C9H18FNO3 — CID 57144056
(3S)-3-(aminomethyl)-6-(fluoromethoxy)-5-methylhexanoic acid (PubChem CID 57144056) has the molecular formula C9H18FNO3 and a molecular weight of 207.24 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-6-(fluoromethoxy)-5-methylhexanoic acid.
| Compound Name | (3S)-3-(aminomethyl)-6-(fluoromethoxy)-5-methylhexanoic acid |
|---|---|
| PubChem CID | 57144056 |
| Molecular Formula | C9H18FNO3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3S)-3-(aminomethyl)-6-(fluoromethoxy)-5-methylhexanoic acid |
| SMILES | CC(COCF)CC(CN)CC(=O)O |
| InChI | InChI=1S/C9H18FNO3/c1-7(5-14-6-10)2-8(4-11)3-9(12)13/h7-8H,2-6,11H2,1H3,(H,12,13) |
| InChIKey | OLNFZYBQOUBMKG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |