C11H16F3NO4 — CID 57144618
ethyl 2-ethoxy-3-[(4,4,4-trifluoro-3-oxobutylidene)amino]propanoate (PubChem CID 57144618) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[(4,4,4-trifluoro-3-oxobutylidene)amino]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[(4,4,4-trifluoro-3-oxobutylidene)amino]propanoate |
|---|---|
| PubChem CID | 57144618 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 2-ethoxy-3-[(4,4,4-trifluoro-3-oxobutylidene)amino]propanoate |
| SMILES | CCOC(=O)C(C/N=C/CC(=O)C(F)(F)F)OCC |
| InChI | InChI=1S/C11H16F3NO4/c1-3-18-8(10(17)19-4-2)7-15-6-5-9(16)11(12,13)14/h6,8H,3-5,7H2,1-2H3/b15-6+ |
| InChIKey | QYHXNEQSHZRMBE-GIDUJCDVSA-N |
| XLogP | 1.55 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|