C32H36N4 — CID 57145598
2-[(4-benzhydrylpiperazin-1-yl)methyl]-N-methyl-4-[4-(methylamino)phenyl]aniline (PubChem CID 57145598) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2-[(4-benzhydrylpiperazin-1-yl)methyl]-N-methyl-4-[4-(methylamino)phenyl]aniline.
| Compound Name | 2-[(4-benzhydrylpiperazin-1-yl)methyl]-N-methyl-4-[4-(methylamino)phenyl]aniline |
|---|---|
| PubChem CID | 57145598 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-[(4-benzhydrylpiperazin-1-yl)methyl]-N-methyl-4-[4-(methylamino)phenyl]aniline |
| SMILES | CNc1ccc(-c2ccc(NC)c(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)c2)cc1 |
| InChI | InChI=1S/C32H36N4/c1-33-30-16-13-25(14-17-30)28-15-18-31(34-2)29(23-28)24-35-19-21-36(22-20-35)32(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-18,23,32-34H,19-22,24H2,1-2H3 |
| InChIKey | YHZUOJRILBMANE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |