C14H17NO3 — CID 57147958
(3S,3aR,7aS)-1-benzyl-3-hydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-2-one (PubChem CID 57147958) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (3S,3aR,7aS)-1-benzyl-3-hydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-2-one.
| Compound Name | (3S,3aR,7aS)-1-benzyl-3-hydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 57147958 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3S,3aR,7aS)-1-benzyl-3-hydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-2-one |
| SMILES | O=C1[C@@H](O)[C@@H]2OCCC[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO3/c16-12-13-11(7-4-8-18-13)15(14(12)17)9-10-5-2-1-3-6-10/h1-3,5-6,11-13,16H,4,7-9H2/t11-,12-,13+/m0/s1 |
| InChIKey | RXDYDAALUIRZEE-RWMBFGLXSA-N |
| XLogP | 0.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |