C9H11NS — CID 57149168
1-ethyl-2H-1,3-benzothiazole (PubChem CID 57149168) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 1-ethyl-2H-1,3-benzothiazole.
| Compound Name | 1-ethyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 57149168 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1-ethyl-2H-1,3-benzothiazole |
| SMILES | CCS1=c2ccccc2=NC1 |
| InChI | InChI=1S/C9H11NS/c1-2-11-7-10-8-5-3-4-6-9(8)11/h3-6H,2,7H2,1H3 |
| InChIKey | IBNUEJGCTZCLDP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|