C7H7NS — CID 50923656
2,4-dihydro-1,3-benzothiazole (PubChem CID 50923656) has the molecular formula C7H7NS and a molecular weight of 137.21 g/mol. Its IUPAC name is 2,4-dihydro-1,3-benzothiazole.
| Compound Name | 2,4-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 50923656 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 2,4-dihydro-1,3-benzothiazole |
| SMILES | C1=CCC2=NCSC2=C1 |
| InChI | InChI=1S/C7H7NS/c1-2-4-7-6(3-1)8-5-9-7/h1-2,4H,3,5H2 |
| InChIKey | SRTGUVICQPIWOY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |