About 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide
1-ethyl-2H-1,3-benzothiazol-2-ylium iodide (PubChem CID 88634789) has the molecular formula C9H10INS
and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide.
Molecular Properties
| Compound Name | 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide |
| PubChem CID | 88634789 |
| Molecular Formula | C9H10INS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide |
| SMILES | CCS1=c2ccccc2=N[CH+]1.[I-] |
| InChI | InChI=1S/C9H10NS.HI/c1-2-11-7-10-8-5-3-4-6-9(8)11;/h3-7H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | NMHYOJRMWHTHKG-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide?
The IUPAC name of 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide (CID 88634789) is 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide.
What is the SMILES notation for 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide?
The canonical SMILES for 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide is CCS1=c2ccccc2=N[CH+]1.[I-].
What is the InChIKey of 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide?
The InChIKey is NMHYOJRMWHTHKG-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10NS.HI/c1-2-11-7-10-8-5-3-4-6-9(8)11;/h3-7H,2H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide?
1-ethyl-2H-1,3-benzothiazol-2-ylium iodide has a molecular weight of 291.16 g/mol, XLogP of -1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2H-1,3-benzothiazol-2-ylium iodide is sourced from PubChem (CID 88634789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).