C15H29NO4S — CID 57150230
(4S)-4-amino-6-cyclohexyl-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]hexane-2,3-dione (PubChem CID 57150230) has the molecular formula C15H29NO4S and a molecular weight of 319.47 g/mol. Its IUPAC name is (4S)-4-amino-6-cyclohexyl-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]hexane-2,3-dione.
| Compound Name | (4S)-4-amino-6-cyclohexyl-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]hexane-2,3-dione |
|---|---|
| PubChem CID | 57150230 |
| Molecular Formula | C15H29NO4S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (4S)-4-amino-6-cyclohexyl-1-[dihydroxy(propan-2-yl)-λ4-sulfanyl]hexane-2,3-dione |
| SMILES | CC(C)S(O)(O)CC(=O)C(=O)[C@@H](N)CCC1CCCCC1 |
| InChI | InChI=1S/C15H29NO4S/c1-11(2)21(19,20)10-14(17)15(18)13(16)9-8-12-6-4-3-5-7-12/h11-13,19-20H,3-10,16H2,1-2H3/t13-/m0/s1 |
| InChIKey | POPVWRZLAHQLER-ZDUSSCGKSA-N |
| XLogP | 2.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|