C7H12N2O — CID 57152000
1-methyl-5-(nitrosomethyl)-3,6-dihydro-2H-pyridine (PubChem CID 57152000) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-methyl-5-(nitrosomethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-methyl-5-(nitrosomethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 57152000 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1-methyl-5-(nitrosomethyl)-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC=C(CN=O)C1 |
| InChI | InChI=1S/C7H12N2O/c1-9-4-2-3-7(6-9)5-8-10/h3H,2,4-6H2,1H3 |
| InChIKey | CMJRMMGKKNJNDF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|