C7H14N2O — CID 117206000
O-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]hydroxylamine (PubChem CID 117206000) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is O-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]hydroxylamine.
| Compound Name | O-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117206000 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | O-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]hydroxylamine |
| SMILES | CN1CCC=C(CON)C1 |
| InChI | InChI=1S/C7H14N2O/c1-9-4-2-3-7(5-9)6-10-8/h3H,2,4-6,8H2,1H3 |
| InChIKey | XQMFDRZEROWKDL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|