C13H14N2O3 — CID 57152868
[3-[(2S)-2-amino-3-oxopropyl]-1H-indol-5-yl] acetate (PubChem CID 57152868) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is [3-[(2S)-2-amino-3-oxopropyl]-1H-indol-5-yl] acetate.
| Compound Name | [3-[(2S)-2-amino-3-oxopropyl]-1H-indol-5-yl] acetate |
|---|---|
| PubChem CID | 57152868 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [3-[(2S)-2-amino-3-oxopropyl]-1H-indol-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2[nH]cc(C[C@H](N)C=O)c2c1 |
| InChI | InChI=1S/C13H14N2O3/c1-8(17)18-11-2-3-13-12(5-11)9(6-15-13)4-10(14)7-16/h2-3,5-7,10,15H,4,14H2,1H3/t10-/m0/s1 |
| InChIKey | PCTJTDWLPURJGA-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|