C19H30O3 — CID 57154773
(3aR,4R,5S,6aS)-4-(4,4-dimethylnon-7-enoyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 57154773) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3aR,4R,5S,6aS)-4-(4,4-dimethylnon-7-enoyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,4R,5S,6aS)-4-(4,4-dimethylnon-7-enoyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 57154773 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3aR,4R,5S,6aS)-4-(4,4-dimethylnon-7-enoyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC=CCCC(C)(C)CCC(=O)[C@@H]1[C@@H]2CC(=O)C[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C19H30O3/c1-4-5-6-8-19(2,3)9-7-16(21)18-15-12-14(20)10-13(15)11-17(18)22/h4-5,13,15,17-18,22H,6-12H2,1-3H3/t13-,15-,17+,18+/m1/s1 |
| InChIKey | AOSFXMOELCTJDL-WCZJQEMASA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|