C26H40N6O4 — CID 57155542
tert-butyl N-[(3S,6S,8aR)-6-benzyl-3-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxo-1,2,3,7,8,8a-hexahydroindolizin-6-yl]carbamate (PubChem CID 57155542) has the molecular formula C26H40N6O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is tert-butyl N-[(3S,6S,8aR)-6-benzyl-3-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxo-1,2,3,7,8,8a-hexahydroindolizin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6S,8aR)-6-benzyl-3-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxo-1,2,3,7,8,8a-hexahydroindolizin-6-yl]carbamate |
|---|---|
| PubChem CID | 57155542 |
| Molecular Formula | C26H40N6O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | tert-butyl N-[(3S,6S,8aR)-6-benzyl-3-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxo-1,2,3,7,8,8a-hexahydroindolizin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@]1(Cc2ccccc2)CC[C@@H]2CC[C@@H](NC(C=O)CCCN=C(N)N)N2C1=O |
| InChI | InChI=1S/C26H40N6O4/c1-25(2,3)36-24(35)31-26(16-18-8-5-4-6-9-18)14-13-20-11-12-21(32(20)22(26)34)30-19(17-33)10-7-15-29-23(27)28/h4-6,8-9,17,19-21,30H,7,10-16H2,1-3H3,(H,31,35)(H4,27,28,29)/t19?,20-,21-,26-/m0/s1 |
| InChIKey | MQRBCNCWOSQZDT-ARDHXNPSSA-N |
| XLogP | 1.81 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|