C31H38N6O7 — CID 57277704
(2S)-2-[(6-acetamido-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizine-3-carbonyl)amino]-5-[[amino(phenylmethoxycarbonylamino)methylidene]amino]pentanoic acid (PubChem CID 57277704) has the molecular formula C31H38N6O7 and a molecular weight of 606.68 g/mol. Its IUPAC name is (2S)-2-[(6-acetamido-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizine-3-carbonyl)amino]-5-[[amino(phenylmethoxycarbonylamino)methylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-[(6-acetamido-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizine-3-carbonyl)amino]-5-[[amino(phenylmethoxycarbonylamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 57277704 |
| Molecular Formula | C31H38N6O7 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (2S)-2-[(6-acetamido-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizine-3-carbonyl)amino]-5-[[amino(phenylmethoxycarbonylamino)methylidene]amino]pentanoic acid |
| SMILES | CC(=O)NC1(Cc2ccccc2)CC2CCC(C(=O)N[C@@H](CCC/N=C(\N)NC(=O)OCc3ccccc3)C(=O)O)N2C1=O |
| InChI | InChI=1S/C31H38N6O7/c1-20(38)36-31(17-21-9-4-2-5-10-21)18-23-14-15-25(37(23)28(31)42)26(39)34-24(27(40)41)13-8-16-33-29(32)35-30(43)44-19-22-11-6-3-7-12-22/h2-7,9-12,23-25H,8,13-19H2,1H3,(H,34,39)(H,36,38)(H,40,41)(H3,32,33,35,43)/t23?,24-,25?,31?/m0/s1 |
| InChIKey | DKGNAUFZKGUPKK-NSZSLQLDSA-N |
| XLogP | 1.46 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|