C15H19NO2 — CID 57155967
3-tert-butyl-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (PubChem CID 57155967) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-tert-butyl-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
| Compound Name | 3-tert-butyl-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 57155967 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-tert-butyl-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)C)CO1 |
| InChI | InChI=1S/C15H19NO2/c1-11-13(12-8-6-5-7-9-12)14(17)16(10-18-11)15(2,3)4/h5-9H,10H2,1-4H3 |
| InChIKey | LVFAUABEFNQBQK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |