C10H17Br3 — CID 57159132
3,6,7-tribromodec-1-ene (PubChem CID 57159132) has the molecular formula C10H17Br3 and a molecular weight of 376.96 g/mol. Its IUPAC name is 3,6,7-tribromodec-1-ene.
| Compound Name | 3,6,7-tribromodec-1-ene |
|---|---|
| PubChem CID | 57159132 |
| Molecular Formula | C10H17Br3 |
| Molecular Weight | 376.96 g/mol |
| Exact Mass | 373.89 |
| IUPAC Name | 3,6,7-tribromodec-1-ene |
| SMILES | C=CC(Br)CCC(Br)C(Br)CCC |
| InChI | InChI=1S/C10H17Br3/c1-3-5-9(12)10(13)7-6-8(11)4-2/h4,8-10H,2-3,5-7H2,1H3 |
| InChIKey | XSMRUPQYTZJFNZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.96 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|