C18H13Cl3N2O3 — CID 57160192
5,7-dichloro-4-[2-(3-chloroanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid (PubChem CID 57160192) has the molecular formula C18H13Cl3N2O3 and a molecular weight of 411.67 g/mol. Its IUPAC name is 5,7-dichloro-4-[2-(3-chloroanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[2-(3-chloroanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 57160192 |
| Molecular Formula | C18H13Cl3N2O3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 5,7-dichloro-4-[2-(3-chloroanilino)-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
| SMILES | O=C(C=C1CC(C(=O)O)Nc2cc(Cl)cc(Cl)c21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13Cl3N2O3/c19-10-2-1-3-12(6-10)22-16(24)5-9-4-15(18(25)26)23-14-8-11(20)7-13(21)17(9)14/h1-3,5-8,15,23H,4H2,(H,22,24)(H,25,26) |
| InChIKey | BSVFJXLOAIUPSE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|