C21H15Cl2N3O3 — CID 70127994
5,7-dichloro-4-[2-[4-(2-cyanoethenyl)anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid (PubChem CID 70127994) has the molecular formula C21H15Cl2N3O3 and a molecular weight of 428.28 g/mol. Its IUPAC name is 5,7-dichloro-4-[2-[4-(2-cyanoethenyl)anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[2-[4-(2-cyanoethenyl)anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 70127994 |
| Molecular Formula | C21H15Cl2N3O3 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 5,7-dichloro-4-[2-[4-(2-cyanoethenyl)anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
| SMILES | N#CC=Cc1ccc(NC(=O)C=C2CC(C(=O)O)Nc3cc(Cl)cc(Cl)c32)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O3/c22-14-10-16(23)20-13(8-18(21(28)29)26-17(20)11-14)9-19(27)25-15-5-3-12(4-6-15)2-1-7-24/h1-6,9-11,18,26H,8H2,(H,25,27)(H,28,29) |
| InChIKey | VYKWQSPCPSZFIS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|