C36H33N5O4 — CID 57164625
N-[(2S)-6-(diaminomethyl)-3,5,7-trioxo-1,8-diphenyl-8-pyridin-2-yloctan-2-yl]quinoline-8-carboxamide (PubChem CID 57164625) has the molecular formula C36H33N5O4 and a molecular weight of 599.69 g/mol. Its IUPAC name is N-[(2S)-6-(diaminomethyl)-3,5,7-trioxo-1,8-diphenyl-8-pyridin-2-yloctan-2-yl]quinoline-8-carboxamide.
| Compound Name | N-[(2S)-6-(diaminomethyl)-3,5,7-trioxo-1,8-diphenyl-8-pyridin-2-yloctan-2-yl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 57164625 |
| Molecular Formula | C36H33N5O4 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | N-[(2S)-6-(diaminomethyl)-3,5,7-trioxo-1,8-diphenyl-8-pyridin-2-yloctan-2-yl]quinoline-8-carboxamide |
| SMILES | NC(N)C(C(=O)CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2cccnc12)C(=O)C(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C36H33N5O4/c37-35(38)32(34(44)31(24-13-5-2-6-14-24)27-18-7-8-19-39-27)30(43)22-29(42)28(21-23-11-3-1-4-12-23)41-36(45)26-17-9-15-25-16-10-20-40-33(25)26/h1-20,28,31-32,35H,21-22,37-38H2,(H,41,45)/t28-,31?,32?/m0/s1 |
| InChIKey | LZMYJAGLGHHRLU-QPTSNOEKSA-N |
| XLogP | 3.76 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|