C21H33FN4O4 — CID 57165852
tert-butyl N-[amino-[N-ethyl-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]anilino]methylidene]carbamate (PubChem CID 57165852) has the molecular formula C21H33FN4O4 and a molecular weight of 424.52 g/mol. Its IUPAC name is tert-butyl N-[amino-[N-ethyl-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]anilino]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[N-ethyl-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]anilino]methylidene]carbamate |
|---|---|
| PubChem CID | 57165852 |
| Molecular Formula | C21H33FN4O4 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl N-[amino-[N-ethyl-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]anilino]methylidene]carbamate |
| SMILES | CCN(C(N)=NC(=O)OC(C)(C)C)c1ccc(CCNC(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C21H33FN4O4/c1-8-26(17(23)25-19(28)30-21(5,6)7)16-10-9-14(13-15(16)22)11-12-24-18(27)29-20(2,3)4/h9-10,13H,8,11-12H2,1-7H3,(H,24,27)(H2,23,25,28) |
| InChIKey | KFPXTHJXMMBZJD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|