C11H22N4O — CID 57165918
2-(diethylamino)-N-[(3-methyl-2H-imidazol-1-yl)methyl]acetamide (PubChem CID 57165918) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(3-methyl-2H-imidazol-1-yl)methyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[(3-methyl-2H-imidazol-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 57165918 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-(diethylamino)-N-[(3-methyl-2H-imidazol-1-yl)methyl]acetamide |
| SMILES | CCN(CC)CC(=O)NCN1C=CN(C)C1 |
| InChI | InChI=1S/C11H22N4O/c1-4-14(5-2)8-11(16)12-9-15-7-6-13(3)10-15/h6-7H,4-5,8-10H2,1-3H3,(H,12,16) |
| InChIKey | NRNBQQGEWXQNJJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |