C42H42Cl2N6O8 — CID 57166588
bis[4-[[(4-chlorobenzoyl)amino]methyl]-1-(pyridin-4-ylcarbamoyl)cyclohexyl] oxalate (PubChem CID 57166588) has the molecular formula C42H42Cl2N6O8 and a molecular weight of 829.74 g/mol. Its IUPAC name is bis[4-[[(4-chlorobenzoyl)amino]methyl]-1-(pyridin-4-ylcarbamoyl)cyclohexyl] oxalate.
| Compound Name | bis[4-[[(4-chlorobenzoyl)amino]methyl]-1-(pyridin-4-ylcarbamoyl)cyclohexyl] oxalate |
|---|---|
| PubChem CID | 57166588 |
| Molecular Formula | C42H42Cl2N6O8 |
| Molecular Weight | 829.74 g/mol |
| Exact Mass | 828.24 |
| IUPAC Name | bis[4-[[(4-chlorobenzoyl)amino]methyl]-1-(pyridin-4-ylcarbamoyl)cyclohexyl] oxalate |
| SMILES | O=C(OC1(C(=O)Nc2ccncc2)CCC(CNC(=O)c2ccc(Cl)cc2)CC1)C(=O)OC1(C(=O)Nc2ccncc2)CCC(CNC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C42H42Cl2N6O8/c43-31-5-1-29(2-6-31)35(51)47-25-27-9-17-41(18-10-27,39(55)49-33-13-21-45-22-14-33)57-37(53)38(54)58-42(40(56)50-34-15-23-46-24-16-34)19-11-28(12-20-42)26-48-36(52)30-3-7-32(44)8-4-30/h1-8,13-16,21-24,27-28H,9-12,17-20,25-26H2,(H,47,51)(H,48,52)(H,45,49,55)(H,46,50,56) |
| InChIKey | VUQDKACXNZQFPD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 194.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|