C6H13NS2 — CID 57171624
N,N-dimethyl-2-sulfanylbutanethioamide (PubChem CID 57171624) has the molecular formula C6H13NS2 and a molecular weight of 163.31 g/mol. Its IUPAC name is N,N-dimethyl-2-sulfanylbutanethioamide.
| Compound Name | N,N-dimethyl-2-sulfanylbutanethioamide |
|---|---|
| PubChem CID | 57171624 |
| Molecular Formula | C6H13NS2 |
| Molecular Weight | 163.31 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | N,N-dimethyl-2-sulfanylbutanethioamide |
| SMILES | CCC(S)C(=S)N(C)C |
| InChI | InChI=1S/C6H13NS2/c1-4-5(8)6(9)7(2)3/h5,8H,4H2,1-3H3 |
| InChIKey | NFLDKRJPGPOSPO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|