C5H9NO4S2 — CID 91075483
2-[(2,2-dihydroxyethanethioyl)-methylamino]-2-sulfanylacetic acid (PubChem CID 91075483) has the molecular formula C5H9NO4S2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(2,2-dihydroxyethanethioyl)-methylamino]-2-sulfanylacetic acid.
| Compound Name | 2-[(2,2-dihydroxyethanethioyl)-methylamino]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 91075483 |
| Molecular Formula | C5H9NO4S2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 2-[(2,2-dihydroxyethanethioyl)-methylamino]-2-sulfanylacetic acid |
| SMILES | CN(C(=S)C(O)O)C(S)C(=O)O |
| InChI | InChI=1S/C5H9NO4S2/c1-6(2(11)4(7)8)3(12)5(9)10/h2,5,9-11H,1H3,(H,7,8) |
| InChIKey | IJIRDKVISFGNPV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|