About (4-hydroxy-3-oxopentyl) acetate
(4-hydroxy-3-oxopentyl) acetate (PubChem CID 57172165) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is (4-hydroxy-3-oxopentyl) acetate.
Molecular Properties
| Compound Name | (4-hydroxy-3-oxopentyl) acetate |
| PubChem CID | 57172165 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (4-hydroxy-3-oxopentyl) acetate |
| SMILES | CC(=O)OCCC(=O)C(C)O |
| InChI | InChI=1S/C7H12O4/c1-5(8)7(10)3-4-11-6(2)9/h5,8H,3-4H2,1-2H3 |
| InChIKey | NMGNPXHFFHWTQM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxy-3-oxopentyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3-oxopentyl) acetate?
The IUPAC name of (4-hydroxy-3-oxopentyl) acetate (CID 57172165) is (4-hydroxy-3-oxopentyl) acetate.
What is the SMILES notation for (4-hydroxy-3-oxopentyl) acetate?
The canonical SMILES for (4-hydroxy-3-oxopentyl) acetate is CC(=O)OCCC(=O)C(C)O.
What is the InChIKey of (4-hydroxy-3-oxopentyl) acetate?
The InChIKey is NMGNPXHFFHWTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-5(8)7(10)3-4-11-6(2)9/h5,8H,3-4H2,1-2H3.
What are the key properties of (4-hydroxy-3-oxopentyl) acetate?
(4-hydroxy-3-oxopentyl) acetate has a molecular weight of 160.17 g/mol, XLogP of -0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3-oxopentyl) acetate is sourced from PubChem (CID 57172165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).