C21H29F3O5S2 — CID 57172599
2-[4-[2-hydroxy-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentyl]butylsulfanyl]acetic acid (PubChem CID 57172599) has the molecular formula C21H29F3O5S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-[4-[2-hydroxy-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[2-hydroxy-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57172599 |
| Molecular Formula | C21H29F3O5S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[4-[2-hydroxy-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentyl]butylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCCC1C(O)CCC1SCC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H29F3O5S2/c22-21(23,24)14-4-3-5-16(10-14)29-11-15(25)12-31-19-8-7-18(26)17(19)6-1-2-9-30-13-20(27)28/h3-5,10,15,17-19,25-26H,1-2,6-9,11-13H2,(H,27,28) |
| InChIKey | MGJXVIMIKOXNQM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|