About [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate
[2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate (PubChem CID 57178840) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate |
| PubChem CID | 57178840 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)Oc1ccccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H17NO3S/c16-13(7-10-19)18-12-6-2-1-5-11(12)14(17)15-8-3-4-9-15/h1-2,5-6,19H,3-4,7-10H2 |
| InChIKey | OEHWYVBHYDQNPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate?
The IUPAC name of [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate (CID 57178840) is [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate.
What is the SMILES notation for [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate?
The canonical SMILES for [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate is O=C(CCS)Oc1ccccc1C(=O)N1CCCC1.
What is the InChIKey of [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate?
The InChIKey is OEHWYVBHYDQNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c16-13(7-10-19)18-12-6-2-1-5-11(12)14(17)15-8-3-4-9-15/h1-2,5-6,19H,3-4,7-10H2.
What are the key properties of [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate?
[2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate has a molecular weight of 279.36 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(pyrrolidine-1-carbonyl)phenyl] 3-sulfanylpropanoate is sourced from PubChem (CID 57178840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).