C12H14N2O — CID 57182714
4-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide (PubChem CID 57182714) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 57182714 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide |
| SMILES | NC(=O)N1C=CC(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H14N2O/c13-12(15)14-8-6-11(7-9-14)10-4-2-1-3-5-10/h1-6,8,11H,7,9H2,(H2,13,15) |
| InChIKey | RNIBCNVHIINUNP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |