About 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline
4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline (PubChem CID 125492806) has the molecular formula C17H18N2
and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline.
Molecular Properties
| Compound Name | 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline |
| PubChem CID | 125492806 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline |
| SMILES | Nc1ccc(N2C=C[C@@H](c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C17H18N2/c18-16-6-8-17(9-7-16)19-12-10-15(11-13-19)14-4-2-1-3-5-14/h1-10,12,15H,11,13,18H2/t15-/m1/s1 |
| InChIKey | AHWKNVADQJFIGA-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline?
The IUPAC name of 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline (CID 125492806) is 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline.
What is the SMILES notation for 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline?
The canonical SMILES for 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline is Nc1ccc(N2C=C[C@@H](c3ccccc3)CC2)cc1.
What is the InChIKey of 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline?
The InChIKey is AHWKNVADQJFIGA-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H18N2/c18-16-6-8-17(9-7-16)19-12-10-15(11-13-19)14-4-2-1-3-5-14/h1-10,12,15H,11,13,18H2/t15-/m1/s1.
What are the key properties of 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline?
4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline has a molecular weight of 250.35 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-4-phenyl-3,4-dihydro-2H-pyridin-1-yl]aniline is sourced from PubChem (CID 125492806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).