C15H20 — CID 161261867
(3S,4R)-3,4-dimethyl-7-phenylcycloheptene (PubChem CID 161261867) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethyl-7-phenylcycloheptene.
| Compound Name | (3S,4R)-3,4-dimethyl-7-phenylcycloheptene |
|---|---|
| PubChem CID | 161261867 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (3S,4R)-3,4-dimethyl-7-phenylcycloheptene |
| SMILES | C[C@@H]1C=CC(c2ccccc2)CC[C@H]1C |
| InChI | InChI=1S/C15H20/c1-12-8-10-15(11-9-13(12)2)14-6-4-3-5-7-14/h3-8,10,12-13,15H,9,11H2,1-2H3/t12-,13-,15?/m1/s1 |
| InChIKey | BHUOAIHZXRDHRZ-HCYNLOQUSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|