C13H17N — CID 57110420
1-methyl-5-phenyl-2,3,4,5-tetrahydroazepine (PubChem CID 57110420) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-5-phenyl-2,3,4,5-tetrahydroazepine.
| Compound Name | 1-methyl-5-phenyl-2,3,4,5-tetrahydroazepine |
|---|---|
| PubChem CID | 57110420 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-methyl-5-phenyl-2,3,4,5-tetrahydroazepine |
| SMILES | CN1C=CC(c2ccccc2)CCC1 |
| InChI | InChI=1S/C13H17N/c1-14-10-5-8-13(9-11-14)12-6-3-2-4-7-12/h2-4,6-7,9,11,13H,5,8,10H2,1H3 |
| InChIKey | DPEVBKLLAWVQCX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |