C16H15F2N3OS — CID 57188130
1H-benzimidazol-2-yl-[4-(difluoromethoxy)-3,5-dimethyl-2-pyridinyl]methanethiol (PubChem CID 57188130) has the molecular formula C16H15F2N3OS and a molecular weight of 335.38 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[4-(difluoromethoxy)-3,5-dimethyl-2-pyridinyl]methanethiol.
| Compound Name | 1H-benzimidazol-2-yl-[4-(difluoromethoxy)-3,5-dimethyl-2-pyridinyl]methanethiol |
|---|---|
| PubChem CID | 57188130 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1H-benzimidazol-2-yl-[4-(difluoromethoxy)-3,5-dimethyl-2-pyridinyl]methanethiol |
| SMILES | Cc1cnc(C(S)c2nc3ccccc3[nH]2)c(C)c1OC(F)F |
| InChI | InChI=1S/C16H15F2N3OS/c1-8-7-19-12(9(2)13(8)22-16(17)18)14(23)15-20-10-5-3-4-6-11(10)21-15/h3-7,14,16,23H,1-2H3,(H,20,21) |
| InChIKey | UHHUNWSZITWDOR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|