C26H25NO2 — CID 57191355
(2R,3S)-2-methyl-2-(perylen-3-ylmethylamino)butane-1,3-diol (PubChem CID 57191355) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2R,3S)-2-methyl-2-(perylen-3-ylmethylamino)butane-1,3-diol.
| Compound Name | (2R,3S)-2-methyl-2-(perylen-3-ylmethylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 57191355 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R,3S)-2-methyl-2-(perylen-3-ylmethylamino)butane-1,3-diol |
| SMILES | C[C@H](O)[C@@](C)(CO)NCc1ccc2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C26H25NO2/c1-16(29)26(2,15-28)27-14-18-12-13-23-21-10-4-7-17-6-3-9-20(24(17)21)22-11-5-8-19(18)25(22)23/h3-13,16,27-29H,14-15H2,1-2H3/t16-,26+/m0/s1 |
| InChIKey | OIFSMTQUSATRST-YHAMSUFESA-N |
| XLogP | 4.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|