C31H48I2O — CID 57192249
5,7-di(cyclobutyl)-3,9-dicyclohexyl-4,8-diiodoundeca-4,7-dien-6-one (PubChem CID 57192249) has the molecular formula C31H48I2O and a molecular weight of 690.53 g/mol. Its IUPAC name is 5,7-di(cyclobutyl)-3,9-dicyclohexyl-4,8-diiodoundeca-4,7-dien-6-one.
| Compound Name | 5,7-di(cyclobutyl)-3,9-dicyclohexyl-4,8-diiodoundeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 57192249 |
| Molecular Formula | C31H48I2O |
| Molecular Weight | 690.53 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | 5,7-di(cyclobutyl)-3,9-dicyclohexyl-4,8-diiodoundeca-4,7-dien-6-one |
| SMILES | CCC(C(I)=C(C(=O)C(=C(I)C(CC)C1CCCCC1)C1CCC1)C1CCC1)C1CCCCC1 |
| InChI | InChI=1S/C31H48I2O/c1-3-25(21-13-7-5-8-14-21)29(32)27(23-17-11-18-23)31(34)28(24-19-12-20-24)30(33)26(4-2)22-15-9-6-10-16-22/h21-26H,3-20H2,1-2H3 |
| InChIKey | QYSTVABZOSLWOY-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.53 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|