C23H23F6NO3 — CID 57197450
1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperidine-2-carboxylic acid (PubChem CID 57197450) has the molecular formula C23H23F6NO3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57197450 |
| Molecular Formula | C23H23F6NO3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1CCOC(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23F6NO3/c24-22(25,26)17-8-4-15(5-9-17)20(16-6-10-18(11-7-16)23(27,28)29)33-14-13-30-12-2-1-3-19(30)21(31)32/h4-11,19-20H,1-3,12-14H2,(H,31,32) |
| InChIKey | NYSMSTRKPGOUQN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |